Maple Questions and Posts

These are Posts and Questions associated with the product, Maple

In Maple 2019.2, I'm trying to compute series expansions. For the input
series(1/z^4/(1-z), z=0, 1);
Maple gives me a series of the expression around z=0, truncated to 1 term, i.e.
z^(-4) + O(z^(-3))

But with the input
series(1/z^4/(1-z), z=0, 2);
Maple gives me the result
z^(-4) + z^(-3) + z^(-2) + z^(-1) + 1 + z + O(z^2)

Apparently Maple has decided not to give a series with 2 terms, but a series up to O(z^2). I'm surprised that the third argument of "series" is not treated in a consistent manner. I've restarted the Maple server between the two computations, so it's not a memory effect.

In the above example, this is just a minor annoyance, but I'm actually dealing with huge expressions, and for performance reasons it's important to truncate the series expansion at the desired order and stop further computations. Has anyone encountered this problem?

Hello everyone,

Please how can I caluclate an integrale based on data set (Q) usiing any integral method

thanks


 

restart:

NULL

NULL

NULL

Q := [21521.7, 11966.6, 7859.78, 7947.54, 9667.45, 10206.8, 10934.0, 10925.0, 11151.5, 10964.6, 11009.0, 11087.0, 11164.3, 11215.7, 11272.7, 11319.0, 11354.6, 11386.2, 11413.5, 11436.3, 11456.0, 11473.2, 11488.2, 11501.1, 11512.7, 11523.0, 11532.2, 11540.3, 11547.7, 11554.3, 11560.3, 11565.8, 11570.7, 11575.3, 11579.4, 11583.2, 11586.7, 11590.0, 11592.9, 11595.7, 11598.2, 11600.6]

[21521.7, 11966.6, 7859.78, 7947.54, 9667.45, 10206.8, 10934.0, 10925.0, 11151.5, 10964.6, 11009.0, 11087.0, 11164.3, 11215.7, 11272.7, 11319.0, 11354.6, 11386.2, 11413.5, 11436.3, 11456.0, 11473.2, 11488.2, 11501.1, 11512.7, 11523.0, 11532.2, 11540.3, 11547.7, 11554.3, 11560.3, 11565.8, 11570.7, 11575.3, 11579.4, 11583.2, 11586.7, 11590.0, 11592.9, 11595.7, 11598.2, 11600.6]

(1)

``

NULL


 

Download simpson.mw

I think there is a special needed package for this : student vector-calculus ?

 

Hi, 

I ran this command
c := NeutralSpread(Color("RGB", "Yellow"), 10);
and I wonder how I could get the  NearestNameColor of all elements in list  c ?


Thanks in advance

example let P be a permutation: P: = Matrix ([[1,2,3], [4,5,6]])
calculate P ^ 4567 knowing that the order of P = 20

Is it possible to import 3rd party python packages like pyGPGO (A  Bayesian Optimization package) available in github. Please reply. Thanks a lot 

Can Maple solve a (simple) nonlinear diophantine equation with restrictions on the variables?

For example, I would like to solve simple equations where all values of the variables are positive integers.

I have tried isolve. For example:

isolve({29 = x^2 + y^2, 1 <= x, 1 <= y})

and

{isolve}({29 = x^2 + y^2, 1 <= x, 1 <= y})

but they just give a warning (and no solutions):

Warning, solutions may have been lost

 

The uploaded worksheet contains a contourplot whose display I can't understand. Can you explain it?

Countourplot.mw

From Wikipedia,

However, when I plug the formula of u(x, t) into Maple, it doesn't seem to satisfy the PDE and is stuck evaluating.
 

restart

eq := diff(u(x, t), t)-k*(diff(u(x, t), x, x)) = f(x, t)

diff(u(x, t), t)-k*(diff(diff(u(x, t), x), x)) = f(x, t)

(1)

ic := u(x, 0) = 0

u(x, 0) = 0

(2)

"G(x,t):=1/(sqrt(4*pi*k*t))exp(-(x^(2))/(4*k*t))"

proc (x, t) options operator, arrow, function_assign; exp(-(1/4)*x^2/(k*t))/sqrt(4*pi*k*t) end proc

(3)

ans := u(x, t) = int(G(x-y, t-s)*f(y, s), y = -infinity .. infinity, s = 0 .. t)

u(x, t) = (1/2)*(int((int(exp(-(1/4)*(x-y)^2/(k*(t-s)))*f(y, s), y = -infinity .. infinity))/(pi*k*(t-s))^(1/2), s = 0 .. t))

(4)

`assuming`([simplify(pdetest(ans, [eq, ic]))], [t > 0])

``


 

Download InhomoHeat.mw

Hi there.

Is it possible to erase previous value of output field and to put new value into it?

For example, I want instead this:

to get something like this:

after first iteration

after fifth iteration

and after tenth iteration

How I can do it?

how to determine the matrix of a permutation by knowing the orbit in Maple?

I would like to know whether ganso optimization toolbox still available for maple. If so please provide the link for the same. Thank you.

Does anyone use a windows 10 code editor like, emacs, vim, or other with good textual layout, error and type checking? for building procedure files (libraries)?

 

I am using Maple2019.   I have been using a code region started in a worksheet and then exported to mpl file.   Not sure if I have really seen a debugger with breakpoints, step-in/step-out, type checking?   Am I just not looking in the right area?

 

Best practices from programmers of maple procedures appreciated.

Bill

 

The uploaded worksheet contains two examples of the use of VectorCalculus[VectorSpace]. The first example seems explicable but the second does not.

I have tried and failed to find a full, clear explanation of how a vector describing a simple vector, spacecurve, or surface in the default vector space is transformed to appear in a user defined vector space.

Can anyone direct me to such an explanation, so that I can understand Maple's processing within the uploaded worksheet and enable me to use this Maple feature to future advantage?

VectorSpaceTest.mw

Why doesn't Maple show a solution to the following odesys of second order and not show an error?
 

Differential Equations Trebuchet, Phase II_2020-06-05

 

restart; with(VariationalCalculus); with(PDETools)

[ConjugateEquation, Convex, EulerLagrange, Jacobi, Weierstrass]

(1)

r1_num := 8; r2_num := 8; r3_num := 1; h_num := 5; m2_num := 1; m3_num := 20; theta3_num := r3_num^2*m3_num; g_num := 10; phi1_num_null := -h_num/r1_num; epsilon_num_null := 0

0

(2)

T := (1/2)*m2*((diff(phi1(t), t))^2*r1^2-2*(diff(phi1(t), t))*(diff(`&epsilon;`(t), t))*r1*r2*sin(phi1(t)+`&epsilon;`(t))+(diff(`&epsilon;`(t), t))^2*r2^2)+(1/2)*m3*(r3^2*(diff(phi1(t), t))^2*sin(phi1(t))^2+r3^2*(diff(phi1(t), t))^2*cos(phi1(t))^2)

(1/2)*m2*((diff(phi1(t), t))^2*r1^2-2*(diff(phi1(t), t))*(diff(epsilon(t), t))*r1*r2*sin(phi1(t)+epsilon(t))+(diff(epsilon(t), t))^2*r2^2)+(1/2)*m3*(r3^2*(diff(phi1(t), t))^2*sin(phi1(t))^2+r3^2*(diff(phi1(t), t))^2*cos(phi1(t))^2)

(3)

NULL

U := m2*g*(r1*sin(phi1(t))+r2*cos(`&epsilon;`(t)))-m3*g*r3*sin(phi1(t))

m2*g*(r1*sin(phi1(t))+r2*cos(epsilon(t)))-m3*g*r3*sin(phi1(t))

(4)

L := T-U = 0

(1/2)*m2*((diff(phi1(t), t))^2*r1^2-2*(diff(phi1(t), t))*(diff(epsilon(t), t))*r1*r2*sin(phi1(t)+epsilon(t))+(diff(epsilon(t), t))^2*r2^2)+(1/2)*m3*(r3^2*(diff(phi1(t), t))^2*sin(phi1(t))^2+r3^2*(diff(phi1(t), t))^2*cos(phi1(t))^2)-m2*g*(r1*sin(phi1(t))+r2*cos(epsilon(t)))+m3*g*r3*sin(phi1(t)) = 0

(5)

L_num := subs(r1 = r1_num, r2 = r2_num, r3 = 1, h = h_num, m2 = m2_num, m3 = m3_num, theta3 = theta3_num, g = g_num, L); combine(%)

42*(diff(phi1(t), t))^2-64*(diff(phi1(t), t))*(diff(epsilon(t), t))*sin(phi1(t)+epsilon(t))+32*(diff(epsilon(t), t))^2+120*sin(phi1(t))-80*cos(epsilon(t)) = 0

(6)

 

deq_phi1_num := EulerLagrange(L_num, t, phi1(t)); hz1 := convert(deq_phi1_num, list); deq_phi1_num := op(1, hz1)

-64*(diff(phi1(t), t))*(D(epsilon))(t)*cos(phi1(t)+epsilon(t))+120*cos(phi1(t))-64*(diff(diff(phi1(t), t), t))+64*((D@@2)(epsilon))(t)*sin(phi1(t)+epsilon(t))+64*(D(epsilon))(t)*(diff(phi1(t), t)+diff(epsilon(t), t))*cos(phi1(t)+epsilon(t))-20*(diff(diff(phi1(t), t), t))*sin(phi1(t))^2-20*(diff(diff(phi1(t), t), t))*cos(phi1(t))^2 = 0

(7)

``

deq_epsilon_num := EulerLagrange(L_num, t, epsilon(t)); hz2 := convert(deq_epsilon_num, list); deq_epsilon_num := op(1, hz2)

-64*(D(phi1))(t)*(diff(epsilon(t), t))*cos(phi1(t)+epsilon(t))+80*sin(epsilon(t))+64*((D@@2)(phi1))(t)*sin(phi1(t)+epsilon(t))+64*(D(phi1))(t)*(diff(phi1(t), t)+diff(epsilon(t), t))*cos(phi1(t)+epsilon(t))-64*(diff(diff(epsilon(t), t), t)) = 0

(8)

``

ode_sys := deq_phi1_num, deq_epsilon_num

-64*(diff(phi1(t), t))*(D(epsilon))(t)*cos(phi1(t)+epsilon(t))+120*cos(phi1(t))-64*(diff(diff(phi1(t), t), t))+64*((D@@2)(epsilon))(t)*sin(phi1(t)+epsilon(t))+64*(D(epsilon))(t)*(diff(phi1(t), t)+diff(epsilon(t), t))*cos(phi1(t)+epsilon(t))-20*(diff(diff(phi1(t), t), t))*sin(phi1(t))^2-20*(diff(diff(phi1(t), t), t))*cos(phi1(t))^2 = 0, -64*(D(phi1))(t)*(diff(epsilon(t), t))*cos(phi1(t)+epsilon(t))+80*sin(epsilon(t))+64*((D@@2)(phi1))(t)*sin(phi1(t)+epsilon(t))+64*(D(phi1))(t)*(diff(phi1(t), t)+diff(epsilon(t), t))*cos(phi1(t)+epsilon(t))-64*(diff(diff(epsilon(t), t), t)) = 0

(9)

NULL

ics := phi1(0) = phi1_num_null, (D(phi1))(0) = 0, epsilon(0) = epsilon_num_null, (D(epsilon))(0) = 0

phi1(0) = -5/8, (D(phi1))(0) = 0, epsilon(0) = 0, (D(epsilon))(0) = 0

(10)

infolevel := 5

5

(11)

sol_num := dsolve({ics, ode_sys}, {epsilon(t), phi1(t)}, numeric)

proc (x_rkf45) local _res, _dat, _vars, _solnproc, _xout, _ndsol, _pars, _n, _i; option `Copyright (c) 2000 by Waterloo Maple Inc. All rights reserved.`; if 1 < nargs then error "invalid input: too many arguments" end if; _EnvDSNumericSaveDigits := Digits; Digits := 15; if _EnvInFsolve = true then _xout := evalf[_EnvDSNumericSaveDigits](x_rkf45) else _xout := evalf(x_rkf45) end if; _dat := Array(1..4, {(1) = proc (_xin) local _xout, _dtbl, _dat, _vmap, _x0, _y0, _val, _dig, _n, _ne, _nd, _nv, _pars, _ini, _par, _i, _j, _k, _src; option `Copyright (c) 2002 by Waterloo Maple Inc. All rights reserved.`; table( [( "complex" ) = false ] ) _xout := _xin; _pars := []; _dtbl := array( 1 .. 4, [( 1 ) = (array( 1 .. 26, [( 1 ) = (datatype = float[8], order = C_order, storage = rectangular), ( 2 ) = (datatype = float[8], order = C_order, storage = rectangular), ( 3 ) = ([0, 0, 0, Array(1..0, 1..2, {}, datatype = float[8], order = C_order)]), ( 4 ) = (Array(1..63, {(1) = 4, (2) = 4, (3) = 0, (4) = 0, (5) = 0, (6) = 0, (7) = 1, (8) = 0, (9) = 0, (10) = 0, (11) = 0, (12) = 0, (13) = 0, (14) = 0, (15) = 0, (16) = 0, (17) = 0, (18) = 1, (19) = 30000, (20) = 0, (21) = 0, (22) = 1, (23) = 4, (24) = 0, (25) = 1, (26) = 15, (27) = 1, (28) = 0, (29) = 1, (30) = 3, (31) = 3, (32) = 0, (33) = 1, (34) = 0, (35) = 0, (36) = 0, (37) = 0, (38) = 0, (39) = 0, (40) = 0, (41) = 0, (42) = 0, (43) = 1, (44) = 0, (45) = 0, (46) = 0, (47) = 0, (48) = 0, (49) = 0, (50) = 50, (51) = 1, (52) = 0, (53) = 0, (54) = 0, (55) = 0, (56) = 0, (57) = 0, (58) = 0, (59) = 10000, (60) = 0, (61) = 1000, (62) = 0, (63) = 0}, datatype = integer[8])), ( 5 ) = (Array(1..28, {(1) = .0, (2) = 0.10e-5, (3) = .0, (4) = 0.500001e-14, (5) = .0, (6) = 0.3220560812572312e-2, (7) = .0, (8) = 0.10e-5, (9) = .0, (10) = .0, (11) = .0, (12) = .0, (13) = 1.0, (14) = .0, (15) = .49999999999999, (16) = .0, (17) = 1.0, (18) = 1.0, (19) = .0, (20) = .0, (21) = 1.0, (22) = 1.0, (23) = .0, (24) = .0, (25) = 0.10e-14, (26) = .0, (27) = .0, (28) = .0}, datatype = float[8], order = C_order)), ( 6 ) = (Array(1..4, {(1) = .0, (2) = .0, (3) = -.625, (4) = .0}, datatype = float[8], order = C_order)), ( 7 ) = ([Array(1..4, 1..7, {(1, 1) = .0, (1, 2) = .203125, (1, 3) = .3046875, (1, 4) = .75, (1, 5) = .8125, (1, 6) = .40625, (1, 7) = .8125, (2, 1) = 0.6378173828125e-1, (2, 2) = .0, (2, 3) = .279296875, (2, 4) = .27237892150878906, (2, 5) = -0.9686851501464844e-1, (2, 6) = 0.1956939697265625e-1, (2, 7) = .5381584167480469, (3, 1) = 0.31890869140625e-1, (3, 2) = .0, (3, 3) = -.34375, (3, 4) = -.335235595703125, (3, 5) = .2296142578125, (3, 6) = .41748046875, (3, 7) = 11.480712890625, (4, 1) = 0.9710520505905151e-1, (4, 2) = .0, (4, 3) = .40350341796875, (4, 4) = 0.20297467708587646e-1, (4, 5) = -0.6054282188415527e-2, (4, 6) = -0.4770040512084961e-1, (4, 7) = .77858567237854}, datatype = float[8], order = C_order), Array(1..6, 1..6, {(1, 1) = .0, (1, 2) = .0, (1, 3) = .0, (1, 4) = .0, (1, 5) = .0, (1, 6) = 1.0, (2, 1) = .25, (2, 2) = .0, (2, 3) = .0, (2, 4) = .0, (2, 5) = .0, (2, 6) = 1.0, (3, 1) = .1875, (3, 2) = .5625, (3, 3) = .0, (3, 4) = .0, (3, 5) = .0, (3, 6) = 2.0, (4, 1) = .23583984375, (4, 2) = -.87890625, (4, 3) = .890625, (4, 4) = .0, (4, 5) = .0, (4, 6) = .2681884765625, (5, 1) = .1272735595703125, (5, 2) = -.5009765625, (5, 3) = .44921875, (5, 4) = -0.128936767578125e-1, (5, 5) = .0, (5, 6) = 0.626220703125e-1, (6, 1) = -0.927734375e-1, (6, 2) = .626220703125, (6, 3) = -.4326171875, (6, 4) = .1418304443359375, (6, 5) = -0.861053466796875e-1, (6, 6) = .3131103515625}, datatype = float[8], order = C_order), Array(1..6, {(1) = .0, (2) = .386, (3) = .21, (4) = .63, (5) = 1.0, (6) = 1.0}, datatype = float[8], order = C_order), Array(1..6, {(1) = .25, (2) = -.1043, (3) = .1035, (4) = -0.362e-1, (5) = .0, (6) = .0}, datatype = float[8], order = C_order), Array(1..6, 1..5, {(1, 1) = .0, (1, 2) = .0, (1, 3) = .0, (1, 4) = .0, (1, 5) = .0, (2, 1) = 1.544, (2, 2) = .0, (2, 3) = .0, (2, 4) = .0, (2, 5) = .0, (3, 1) = .9466785280815533, (3, 2) = .25570116989825814, (3, 3) = .0, (3, 4) = .0, (3, 5) = .0, (4, 1) = 3.3148251870684886, (4, 2) = 2.896124015972123, (4, 3) = .9986419139977808, (4, 4) = .0, (4, 5) = .0, (5, 1) = 1.2212245092262748, (5, 2) = 6.019134481287752, (5, 3) = 12.537083329320874, (5, 4) = -.687886036105895, (5, 5) = .0, (6, 1) = 1.2212245092262748, (6, 2) = 6.019134481287752, (6, 3) = 12.537083329320874, (6, 4) = -.687886036105895, (6, 5) = 1.0}, datatype = float[8], order = C_order), Array(1..6, 1..5, {(1, 1) = .0, (1, 2) = .0, (1, 3) = .0, (1, 4) = .0, (1, 5) = .0, (2, 1) = -5.6688, (2, 2) = .0, (2, 3) = .0, (2, 4) = .0, (2, 5) = .0, (3, 1) = -2.4300933568337584, (3, 2) = -.20635991570891224, (3, 3) = .0, (3, 4) = .0, (3, 5) = .0, (4, 1) = -.10735290581452621, (4, 2) = -9.594562251021896, (4, 3) = -20.470286148096154, (4, 4) = .0, (4, 5) = .0, (5, 1) = 7.496443313968615, (5, 2) = -10.246804314641219, (5, 3) = -33.99990352819906, (5, 4) = 11.708908932061595, (5, 5) = .0, (6, 1) = 8.083246795922411, (6, 2) = -7.981132988062785, (6, 3) = -31.52159432874373, (6, 4) = 16.319305431231363, (6, 5) = -6.0588182388340535}, datatype = float[8], order = C_order), Array(1..3, 1..5, {(1, 1) = .0, (1, 2) = .0, (1, 3) = .0, (1, 4) = .0, (1, 5) = .0, (2, 1) = 10.126235083446911, (2, 2) = -7.487995877607633, (2, 3) = -34.800918615557414, (2, 4) = -7.9927717075687275, (2, 5) = 1.0251377232956207, (3, 1) = -.6762803392806898, (3, 2) = 6.087714651678606, (3, 3) = 16.43084320892463, (3, 4) = 24.767225114183653, (3, 5) = -6.5943891257167815}, datatype = float[8], order = C_order)]), ( 9 ) = ([Array(1..4, {(1) = .1, (2) = .1, (3) = .1, (4) = .1}, datatype = float[8], order = C_order), Array(1..4, {(1) = .0, (2) = .0, (3) = .0, (4) = .0}, datatype = float[8], order = C_order), Array(1..4, {(1) = .0, (2) = .0, (3) = .0, (4) = .0}, datatype = float[8], order = C_order), Array(1..4, {(1) = .0, (2) = .0, (3) = .0, (4) = .0}, datatype = float[8], order = C_order), Array(1..4, {(1) = .0, (2) = .0, (3) = .0, (4) = .0}, datatype = float[8], order = C_order), Array(1..4, 1..4, {(1, 1) = .0, (1, 2) = .0, (1, 3) = .0, (1, 4) = .0, (2, 1) = .0, (2, 2) = .0, (2, 3) = .0, (2, 4) = .0, (3, 1) = .0, (3, 2) = .0, (3, 3) = .0, (3, 4) = .0, (4, 1) = .0, (4, 2) = .0, (4, 3) = .0, (4, 4) = .0}, datatype = float[8], order = C_order), Array(1..4, 1..4, {(1, 1) = .0, (1, 2) = .0, (1, 3) = .0, (1, 4) = .0, (2, 1) = .0, (2, 2) = .0, (2, 3) = .0, (2, 4) = .0, (3, 1) = .0, (3, 2) = .0, (3, 3) = .0, (3, 4) = .0, (4, 1) = .0, (4, 2) = .0, (4, 3) = .0, (4, 4) = .0}, datatype = float[8], order = C_order), Array(1..4, {(1) = .0, (2) = .0, (3) = .0, (4) = .0}, datatype = float[8], order = C_order), Array(1..4, 1..4, {(1, 1) = .0, (1, 2) = .0, (1, 3) = .0, (1, 4) = .0, (2, 1) = .0, (2, 2) = .0, (2, 3) = .0, (2, 4) = .0, (3, 1) = .0, (3, 2) = .0, (3, 3) = .0, (3, 4) = .0, (4, 1) = .0, (4, 2) = .0, (4, 3) = .0, (4, 4) = .0}, datatype = float[8], order = C_order), Array(1..4, 1..6, {(1, 1) = .0, (1, 2) = .0, (1, 3) = .0, (1, 4) = .0, (1, 5) = .0, (1, 6) = .0, (2, 1) = .0, (2, 2) = .0, (2, 3) = .0, (2, 4) = .0, (2, 5) = .0, (2, 6) = .0, (3, 1) = .0, (3, 2) = .0, (3, 3) = .0, (3, 4) = .0, (3, 5) = .0, (3, 6) = .0, (4, 1) = .0, (4, 2) = .0, (4, 3) = .0, (4, 4) = .0, (4, 5) = .0, (4, 6) = .0}, datatype = float[8], order = C_order), Array(1..4, {(1) = 0, (2) = 0, (3) = 0, (4) = 0}, datatype = integer[8]), Array(1..4, {(1) = .0, (2) = .0, (3) = .0, (4) = .0}, datatype = float[8], order = C_order), Array(1..4, {(1) = .0, (2) = .0, (3) = .0, (4) = .0}, datatype = float[8], order = C_order), Array(1..4, {(1) = .0, (2) = .0, (3) = .0, (4) = .0}, datatype = float[8], order = C_order), Array(1..4, {(1) = .0, (2) = .0, (3) = .0, (4) = .0}, datatype = float[8], order = C_order), Array(1..4, {(1) = .0, (2) = .0, (3) = .0, (4) = .0}, datatype = float[8], order = C_order), Array(1..8, {(1) = .0, (2) = .0, (3) = .0, (4) = .0, (5) = .0, (6) = .0, (7) = .0, (8) = .0}, datatype = float[8], order = C_order)]), ( 8 ) = ([Array(1..4, {(1) = .0, (2) = .0, (3) = -.625, (4) = .0}, datatype = float[8], order = C_order), Array(1..4, {(1) = .0, (2) = .0, (3) = .0, (4) = .0}, datatype = float[8], order = C_order), Array(1..4, {(1) = .0, (2) = -.917036362501732, (3) = .0, (4) = 1.567322913492791}, datatype = float[8], order = C_order), 0, 0]), ( 11 ) = (Array(1..6, 0..4, {(1, 1) = .0, (1, 2) = .0, (1, 3) = .0, (1, 4) = .0, (2, 0) = .0, (2, 1) = .0, (2, 2) = .0, (2, 3) = .0, (2, 4) = .0, (3, 0) = .0, (3, 1) = .0, (3, 2) = .0, (3, 3) = .0, (3, 4) = .0, (4, 0) = .0, (4, 1) = .0, (4, 2) = .0, (4, 3) = .0, (4, 4) = .0, (5, 0) = .0, (5, 1) = .0, (5, 2) = .0, (5, 3) = .0, (5, 4) = .0, (6, 0) = .0, (6, 1) = .0, (6, 2) = .0, (6, 3) = .0, (6, 4) = .0}, datatype = float[8], order = C_order)), ( 10 ) = ([proc (N, X, Y, YP) option `[Y[1] = epsilon(t), Y[2] = diff(epsilon(t),t), Y[3] = phi1(t), Y[4] = diff(phi1(t),t)]`; YP[2] := (64*sin(Y[3]+Y[1])*(-64*Y[4]*Y[2]*cos(Y[3]+Y[1])+120*cos(Y[3])+64*Y[2]*(Y[4]+Y[2])*cos(Y[3]+Y[1]))-(-64*Y[4]*Y[2]*cos(Y[3]+Y[1])+80*sin(Y[1])+64*Y[4]*(Y[4]+Y[2])*cos(Y[3]+Y[1]))*(-20*cos(Y[3])^2-20*sin(Y[3])^2-64))/(1280*cos(Y[3])^2+1280*sin(Y[3])^2+4096-4096*sin(Y[3]+Y[1])^2); YP[4] := -2*(8*cos(Y[3]+Y[1])*sin(Y[3]+Y[1])*Y[4]^2+8*Y[2]^2*cos(Y[3]+Y[1])+10*sin(Y[1])*sin(Y[3]+Y[1])+15*cos(Y[3]))/(16*sin(Y[3]+Y[1])^2-5*cos(Y[3])^2-5*sin(Y[3])^2-16); YP[1] := Y[2]; YP[3] := Y[4]; 0 end proc, -1, 0, 0, 0, 0, 0, 0]), ( 13 ) = (), ( 12 ) = (), ( 15 ) = ("rkf45"), ( 14 ) = ([0, 0]), ( 18 ) = ([]), ( 19 ) = (0), ( 16 ) = ([0, 0, 0, []]), ( 17 ) = ([proc (N, X, Y, YP) option `[Y[1] = epsilon(t), Y[2] = diff(epsilon(t),t), Y[3] = phi1(t), Y[4] = diff(phi1(t),t)]`; YP[2] := (64*sin(Y[3]+Y[1])*(-64*Y[4]*Y[2]*cos(Y[3]+Y[1])+120*cos(Y[3])+64*Y[2]*(Y[4]+Y[2])*cos(Y[3]+Y[1]))-(-64*Y[4]*Y[2]*cos(Y[3]+Y[1])+80*sin(Y[1])+64*Y[4]*(Y[4]+Y[2])*cos(Y[3]+Y[1]))*(-20*cos(Y[3])^2-20*sin(Y[3])^2-64))/(1280*cos(Y[3])^2+1280*sin(Y[3])^2+4096-4096*sin(Y[3]+Y[1])^2); YP[4] := -2*(8*cos(Y[3]+Y[1])*sin(Y[3]+Y[1])*Y[4]^2+8*Y[2]^2*cos(Y[3]+Y[1])+10*sin(Y[1])*sin(Y[3]+Y[1])+15*cos(Y[3]))/(16*sin(Y[3]+Y[1])^2-5*cos(Y[3])^2-5*sin(Y[3])^2-16); YP[1] := Y[2]; YP[3] := Y[4]; 0 end proc, -1, 0, 0, 0, 0, 0, 0]), ( 22 ) = (0), ( 23 ) = (0), ( 20 ) = ([]), ( 21 ) = (0), ( 26 ) = (Array(1..0, {})), ( 25 ) = (Array(1..0, {})), ( 24 ) = (0)  ] ))  ] ); _y0 := Array(0..4, {(1) = 0., (2) = 0., (3) = 0., (4) = -.625000000000000}); _vmap := array( 1 .. 4, [( 1 ) = (1), ( 2 ) = (2), ( 3 ) = (3), ( 4 ) = (4)  ] ); _x0 := _dtbl[1][5][5]; _n := _dtbl[1][4][1]; _ne := _dtbl[1][4][3]; _nd := _dtbl[1][4][4]; _nv := _dtbl[1][4][16]; if not type(_xout, 'numeric') then if member(_xout, ["start", "left", "right"]) then if _Env_smart_dsolve_numeric = true or _dtbl[1][4][10] = 1 then if _xout = "left" then if type(_dtbl[2], 'table') then return _dtbl[2][5][1] end if elif _xout = "right" then if type(_dtbl[3], 'table') then return _dtbl[3][5][1] end if end if end if; return _dtbl[1][5][5] elif _xout = "method" then return _dtbl[1][15] elif _xout = "storage" then return evalb(_dtbl[1][4][10] = 1) elif _xout = "leftdata" then if not type(_dtbl[2], 'array') then return NULL else return eval(_dtbl[2]) end if elif _xout = "rightdata" then if not type(_dtbl[3], 'array') then return NULL else return eval(_dtbl[3]) end if elif _xout = "enginedata" then return eval(_dtbl[1]) elif _xout = "enginereset" then _dtbl[2] := evaln(_dtbl[2]); _dtbl[3] := evaln(_dtbl[3]); return NULL elif _xout = "initial" then return procname(_y0[0]) elif _xout = "laxtol" then return _dtbl[`if`(member(_dtbl[4], {2, 3}), _dtbl[4], 1)][5][18] elif _xout = "numfun" then return `if`(member(_dtbl[4], {2, 3}), _dtbl[_dtbl[4]][4][18], 0) elif _xout = "parameters" then return [seq(_y0[_n+_i], _i = 1 .. nops(_pars))] elif _xout = "initial_and_parameters" then return procname(_y0[0]), [seq(_y0[_n+_i], _i = 1 .. nops(_pars))] elif _xout = "last" then if _dtbl[4] <> 2 and _dtbl[4] <> 3 or _x0-_dtbl[_dtbl[4]][5][1] = 0. then error "no information is available on last computed point" else _xout := _dtbl[_dtbl[4]][5][1] end if elif _xout = "function" then if _dtbl[1][4][33]-2. = 0 then return eval(_dtbl[1][10], 1) else return eval(_dtbl[1][10][1], 1) end if elif _xout = "map" then return copy(_vmap) elif type(_xin, `=`) and type(rhs(_xin), 'list') and member(lhs(_xin), {"initial", "parameters", "initial_and_parameters"}) then _ini, _par := [], []; if lhs(_xin) = "initial" then _ini := rhs(_xin) elif lhs(_xin) = "parameters" then _par := rhs(_xin) elif select(type, rhs(_xin), `=`) <> [] then _par, _ini := selectremove(type, rhs(_xin), `=`) elif nops(rhs(_xin)) < nops(_pars)+1 then error "insufficient data for specification of initial and parameters" else _par := rhs(_xin)[-nops(_pars) .. -1]; _ini := rhs(_xin)[1 .. -nops(_pars)-1] end if; _xout := lhs(_xout); if _par <> [] then `dsolve/numeric/process_parameters`(_n, _pars, _par, _y0) end if; if _ini <> [] then `dsolve/numeric/process_initial`(_n-_ne, _ini, _y0, _pars, _vmap) end if; `dsolve/numeric/SC/reinitialize`(_dtbl, _y0, _n, procname, _pars); if _Env_smart_dsolve_numeric = true and type(_y0[0], 'numeric') and _dtbl[1][4][10] <> 1 then procname("right") := _y0[0]; procname("left") := _y0[0] end if; if _xout = "initial" then return [_y0[0], seq(_y0[_vmap[_i]], _i = 1 .. _n-_ne)] elif _xout = "parameters" then return [seq(_y0[_n+_i], _i = 1 .. nops(_pars))] else return [_y0[0], seq(_y0[_vmap[_i]], _i = 1 .. _n-_ne)], [seq(_y0[_n+_i], _i = 1 .. nops(_pars))] end if elif _xin = "eventstop" then if _nv = 0 then error "this solution has no events" end if; _i := _dtbl[4]; if _i <> 2 and _i <> 3 then return 0 end if; if _dtbl[_i][4][10] = 1 and assigned(_dtbl[5-_i]) and _dtbl[_i][4][9] < 100 and 100 <= _dtbl[5-_i][4][9] then _i := 5-_i; _dtbl[4] := _i; _j := round(_dtbl[_i][4][17]); return round(_dtbl[_i][3][1][_j, 1]) elif 100 <= _dtbl[_i][4][9] then _j := round(_dtbl[_i][4][17]); return round(_dtbl[_i][3][1][_j, 1]) else return 0 end if elif _xin = "eventstatus" then if _nv = 0 then error "this solution has no events" end if; _i := [selectremove(proc (a) options operator, arrow; _dtbl[1][3][1][a, 7] = 1 end proc, {seq(_j, _j = 1 .. round(_dtbl[1][3][1][_nv+1, 1]))})]; return ':-enabled' = _i[1], ':-disabled' = _i[2] elif _xin = "eventclear" then if _nv = 0 then error "this solution has no events" end if; _i := _dtbl[4]; if _i <> 2 and _i <> 3 then error "no events to clear" end if; if _dtbl[_i][4][10] = 1 and assigned(_dtbl[5-_i]) and _dtbl[_i][4][9] < 100 and 100 < _dtbl[5-_i][4][9] then _dtbl[4] := 5-_i; _i := 5-_i end if; if _dtbl[_i][4][9] < 100 then error "no events to clear" elif _nv < _dtbl[_i][4][9]-100 then error "event error condition cannot be cleared" else _j := _dtbl[_i][4][9]-100; if irem(round(_dtbl[_i][3][1][_j, 4]), 2) = 1 then error "retriggerable events cannot be cleared" end if; _j := round(_dtbl[_i][3][1][_j, 1]); for _k to _nv do if _dtbl[_i][3][1][_k, 1] = _j then if _dtbl[_i][3][1][_k, 2] = 3 then error "range events cannot be cleared" end if; _dtbl[_i][3][1][_k, 8] := _dtbl[_i][3][1][_nv+1, 8] end if end do; _dtbl[_i][4][17] := 0; _dtbl[_i][4][9] := 0; if _dtbl[1][4][10] = 1 then if _i = 2 then try procname(procname("left")) catch:  end try else try procname(procname("right")) catch:  end try end if end if end if; return  elif type(_xin, `=`) and member(lhs(_xin), {"eventdisable", "eventenable"}) then if _nv = 0 then error "this solution has no events" end if; if type(rhs(_xin), {('list')('posint'), ('set')('posint')}) then _i := {op(rhs(_xin))} elif type(rhs(_xin), 'posint') then _i := {rhs(_xin)} else error "event identifiers must be integers in the range 1..%1", round(_dtbl[1][3][1][_nv+1, 1]) end if; if select(proc (a) options operator, arrow; _nv < a end proc, _i) <> {} then error "event identifiers must be integers in the range 1..%1", round(_dtbl[1][3][1][_nv+1, 1]) end if; _k := {}; for _j to _nv do if member(round(_dtbl[1][3][1][_j, 1]), _i) then _k := `union`(_k, {_j}) end if end do; _i := _k; if lhs(_xin) = "eventdisable" then _dtbl[4] := 0; _j := [evalb(assigned(_dtbl[2]) and member(_dtbl[2][4][17], _i)), evalb(assigned(_dtbl[3]) and member(_dtbl[3][4][17], _i))]; for _k in _i do _dtbl[1][3][1][_k, 7] := 0; if assigned(_dtbl[2]) then _dtbl[2][3][1][_k, 7] := 0 end if; if assigned(_dtbl[3]) then _dtbl[3][3][1][_k, 7] := 0 end if end do; if _j[1] then for _k to _nv+1 do if _k <= _nv and not type(_dtbl[2][3][4][_k, 1], 'undefined') then userinfo(3, {'events', 'eventreset'}, `reinit #2, event code `, _k, ` to defined init `, _dtbl[2][3][4][_k, 1]); _dtbl[2][3][1][_k, 8] := _dtbl[2][3][4][_k, 1] elif _dtbl[2][3][1][_k, 2] = 0 and irem(iquo(round(_dtbl[2][3][1][_k, 4]), 32), 2) = 1 then userinfo(3, {'events', 'eventreset'}, `reinit #2, event code `, _k, ` to rate hysteresis init `, _dtbl[2][5][24]); _dtbl[2][3][1][_k, 8] := _dtbl[2][5][24] elif _dtbl[2][3][1][_k, 2] = 0 and irem(iquo(round(_dtbl[2][3][1][_k, 4]), 2), 2) = 0 then userinfo(3, {'events', 'eventreset'}, `reinit #2, event code `, _k, ` to initial init `, _x0); _dtbl[2][3][1][_k, 8] := _x0 else userinfo(3, {'events', 'eventreset'}, `reinit #2, event code `, _k, ` to fireinitial init `, _x0-1); _dtbl[2][3][1][_k, 8] := _x0-1 end if end do; _dtbl[2][4][17] := 0; _dtbl[2][4][9] := 0; if _dtbl[1][4][10] = 1 then procname(procname("left")) end if end if; if _j[2] then for _k to _nv+1 do if _k <= _nv and not type(_dtbl[3][3][4][_k, 2], 'undefined') then userinfo(3, {'events', 'eventreset'}, `reinit #3, event code `, _k, ` to defined init `, _dtbl[3][3][4][_k, 2]); _dtbl[3][3][1][_k, 8] := _dtbl[3][3][4][_k, 2] elif _dtbl[3][3][1][_k, 2] = 0 and irem(iquo(round(_dtbl[3][3][1][_k, 4]), 32), 2) = 1 then userinfo(3, {'events', 'eventreset'}, `reinit #3, event code `, _k, ` to rate hysteresis init `, _dtbl[3][5][24]); _dtbl[3][3][1][_k, 8] := _dtbl[3][5][24] elif _dtbl[3][3][1][_k, 2] = 0 and irem(iquo(round(_dtbl[3][3][1][_k, 4]), 2), 2) = 0 then userinfo(3, {'events', 'eventreset'}, `reinit #3, event code `, _k, ` to initial init `, _x0); _dtbl[3][3][1][_k, 8] := _x0 else userinfo(3, {'events', 'eventreset'}, `reinit #3, event code `, _k, ` to fireinitial init `, _x0+1); _dtbl[3][3][1][_k, 8] := _x0+1 end if end do; _dtbl[3][4][17] := 0; _dtbl[3][4][9] := 0; if _dtbl[1][4][10] = 1 then procname(procname("right")) end if end if else for _k in _i do _dtbl[1][3][1][_k, 7] := 1 end do; _dtbl[2] := evaln(_dtbl[2]); _dtbl[3] := evaln(_dtbl[3]); _dtbl[4] := 0; if _dtbl[1][4][10] = 1 then if _x0 <= procname("right") then try procname(procname("right")) catch:  end try end if; if procname("left") <= _x0 then try procname(procname("left")) catch:  end try end if end if end if; return  elif type(_xin, `=`) and lhs(_xin) = "eventfired" then if not type(rhs(_xin), 'list') then error "'eventfired' must be specified as a list" end if; if _nv = 0 then error "this solution has no events" end if; if _dtbl[4] <> 2 and _dtbl[4] <> 3 then error "'direction' must be set prior to calling/setting 'eventfired'" end if; _i := _dtbl[4]; _val := NULL; if not assigned(_EnvEventRetriggerWarned) then _EnvEventRetriggerWarned := false end if; for _k in rhs(_xin) do if type(_k, 'integer') then _src := _k elif type(_k, 'integer' = 'anything') and type(evalf(rhs(_k)), 'numeric') then _k := lhs(_k) = evalf[max(Digits, 18)](rhs(_k)); _src := lhs(_k) else error "'eventfired' entry is not valid: %1", _k end if; if _src < 1 or round(_dtbl[1][3][1][_nv+1, 1]) < _src then error "event identifiers must be integers in the range 1..%1", round(_dtbl[1][3][1][_nv+1, 1]) end if; _src := {seq(`if`(_dtbl[1][3][1][_j, 1]-_src = 0., _j, NULL), _j = 1 .. _nv)}; if nops(_src) <> 1 then error "'eventfired' can only be set/queried for root-finding events and time/interval events" end if; _src := _src[1]; if _dtbl[1][3][1][_src, 2] <> 0. and _dtbl[1][3][1][_src, 2]-2. <> 0. then error "'eventfired' can only be set/queried for root-finding events and time/interval events" elif irem(round(_dtbl[1][3][1][_src, 4]), 2) = 1 then if _EnvEventRetriggerWarned = false then WARNING(`'eventfired' has no effect on events that retrigger`) end if; _EnvEventRetriggerWarned := true end if; if _dtbl[_i][3][1][_src, 2] = 0 and irem(iquo(round(_dtbl[_i][3][1][_src, 4]), 32), 2) = 1 then _val := _val, undefined elif type(_dtbl[_i][3][4][_src, _i-1], 'undefined') or _i = 2 and _dtbl[2][3][1][_src, 8] < _dtbl[2][3][4][_src, 1] or _i = 3 and _dtbl[3][3][4][_src, 2] < _dtbl[3][3][1][_src, 8] then _val := _val, _dtbl[_i][3][1][_src, 8] else _val := _val, _dtbl[_i][3][4][_src, _i-1] end if; if type(_k, `=`) then if _dtbl[_i][3][1][_src, 2] = 0 and irem(iquo(round(_dtbl[_i][3][1][_src, 4]), 32), 2) = 1 then error "cannot set event code for a rate hysteresis event" end if; userinfo(3, {'events', 'eventreset'}, `manual set event code `, _src, ` to value `, rhs(_k)); _dtbl[_i][3][1][_src, 8] := rhs(_k); _dtbl[_i][3][4][_src, _i-1] := rhs(_k) end if end do; return [_val] elif type(_xin, `=`) and lhs(_xin) = "direction" then if not member(rhs(_xin), {-1, 1, ':-left', ':-right'}) then error "'direction' must be specified as either '1' or 'right' (positive) or '-1' or 'left' (negative)" end if; _src := `if`(_dtbl[4] = 2, -1, `if`(_dtbl[4] = 3, 1, undefined)); _i := `if`(member(rhs(_xin), {1, ':-right'}), 3, 2); _dtbl[4] := _i; _dtbl[_i] := `dsolve/numeric/SC/IVPdcopy`(_dtbl[1], `if`(assigned(_dtbl[_i]), _dtbl[_i], NULL)); if 0 < _nv then for _j to _nv+1 do if _j <= _nv and not type(_dtbl[_i][3][4][_j, _i-1], 'undefined') then userinfo(3, {'events', 'eventreset'}, `reinit #4, event code `, _j, ` to defined init `, _dtbl[_i][3][4][_j, _i-1]); _dtbl[_i][3][1][_j, 8] := _dtbl[_i][3][4][_j, _i-1] elif _dtbl[_i][3][1][_j, 2] = 0 and irem(iquo(round(_dtbl[_i][3][1][_j, 4]), 32), 2) = 1 then userinfo(3, {'events', 'eventreset'}, `reinit #4, event code `, _j, ` to rate hysteresis init `, _dtbl[_i][5][24]); _dtbl[_i][3][1][_j, 8] := _dtbl[_i][5][24] elif _dtbl[_i][3][1][_j, 2] = 0 and irem(iquo(round(_dtbl[_i][3][1][_j, 4]), 2), 2) = 0 then userinfo(3, {'events', 'eventreset'}, `reinit #4, event code `, _j, ` to initial init `, _x0); _dtbl[_i][3][1][_j, 8] := _x0 else userinfo(3, {'events', 'eventreset'}, `reinit #4, event code `, _j, ` to fireinitial init `, _x0-2*_i+5.0); _dtbl[_i][3][1][_j, 8] := _x0-2*_i+5.0 end if end do end if; return _src elif _xin = "eventcount" then if _dtbl[1][3][1] = 0 or _dtbl[4] <> 2 and _dtbl[4] <> 3 then return 0 else return round(_dtbl[_dtbl[4]][3][1][_nv+1, 12]) end if else return "procname" end if end if; if _xout = _x0 then return [_x0, seq(evalf(_dtbl[1][6][_vmap[_i]]), _i = 1 .. _n-_ne)] end if; _i := `if`(_x0 <= _xout, 3, 2); if _xin = "last" and 0 < _dtbl[_i][4][9] and _dtbl[_i][4][9] < 100 then _dat := eval(_dtbl[_i], 2); _j := _dat[4][20]; return [_dat[11][_j, 0], seq(_dat[11][_j, _vmap[_i]], _i = 1 .. _n-_ne-_nd), seq(_dat[8][1][_vmap[_i]], _i = _n-_ne-_nd+1 .. _n-_ne)] end if; if not type(_dtbl[_i], 'array') then _dtbl[_i] := `dsolve/numeric/SC/IVPdcopy`(_dtbl[1], `if`(assigned(_dtbl[_i]), _dtbl[_i], NULL)); if 0 < _nv then for _j to _nv+1 do if _j <= _nv and not type(_dtbl[_i][3][4][_j, _i-1], 'undefined') then userinfo(3, {'events', 'eventreset'}, `reinit #5, event code `, _j, ` to defined init `, _dtbl[_i][3][4][_j, _i-1]); _dtbl[_i][3][1][_j, 8] := _dtbl[_i][3][4][_j, _i-1] elif _dtbl[_i][3][1][_j, 2] = 0 and irem(iquo(round(_dtbl[_i][3][1][_j, 4]), 32), 2) = 1 then userinfo(3, {'events', 'eventreset'}, `reinit #5, event code `, _j, ` to rate hysteresis init `, _dtbl[_i][5][24]); _dtbl[_i][3][1][_j, 8] := _dtbl[_i][5][24] elif _dtbl[_i][3][1][_j, 2] = 0 and irem(iquo(round(_dtbl[_i][3][1][_j, 4]), 2), 2) = 0 then userinfo(3, {'events', 'eventreset'}, `reinit #5, event code `, _j, ` to initial init `, _x0); _dtbl[_i][3][1][_j, 8] := _x0 else userinfo(3, {'events', 'eventreset'}, `reinit #5, event code `, _j, ` to fireinitial init `, _x0-2*_i+5.0); _dtbl[_i][3][1][_j, 8] := _x0-2*_i+5.0 end if end do end if end if; if _xin <> "last" then if 0 < 0 then if `dsolve/numeric/checkglobals`(op(_dtbl[1][14]), _pars, _n, _y0) then `dsolve/numeric/SC/reinitialize`(_dtbl, _y0, _n, procname, _pars, _i) end if end if; if _dtbl[1][4][7] = 0 then error "parameters must be initialized before solution can be computed" end if end if; _dat := eval(_dtbl[_i], 2); _dtbl[4] := _i; try _src := `dsolve/numeric/SC/IVPrun`(_dat, _xout) catch: userinfo(2, `dsolve/debug`, print(`Exception in solnproc:`, [lastexception][2 .. -1])); error  end try; if _dat[17] <> _dtbl[1][17] then _dtbl[1][17] := _dat[17]; _dtbl[1][10] := _dat[10] end if; if _src = 0 and 100 < _dat[4][9] then _val := _dat[3][1][_nv+1, 8] else _val := _dat[11][_dat[4][20], 0] end if; if _src <> 0 or _dat[4][9] <= 0 then _dtbl[1][5][1] := _xout else _dtbl[1][5][1] := _val end if; if _i = 3 and _val < _xout then Rounding := -infinity; if _dat[4][9] = 1 then error "cannot evaluate the solution further right of %1, probably a singularity", evalf[8](_val) elif _dat[4][9] = 2 then error "cannot evaluate the solution further right of %1, maxfun limit exceeded (see <a href='http://www.maplesoft.com/support/help/search.aspx?term=dsolve,maxfun' target='_new'>?dsolve,maxfun</a> for details)", evalf[8](_val) elif _dat[4][9] = 3 then if _dat[4][25] = 3 then error "cannot evaluate the solution past the initial point, problem may be initially singular or improperly set up" else error "cannot evaluate the solution past the initial point, problem may be complex, initially singular or improperly set up" end if elif _dat[4][9] = 4 then error "cannot evaluate the solution further right of %1, accuracy goal cannot be achieved with specified 'minstep'", evalf[8](_val) elif _dat[4][9] = 5 then error "cannot evaluate the solution further right of %1, too many step failures, tolerances may be too loose for problem", evalf[8](_val) elif _dat[4][9] = 6 then error "cannot evaluate the solution further right of %1, cannot downgrade delay storage for problems with delay derivative order > 1, try increasing delaypts", evalf[8](_val) elif _dat[4][9] = 10 then error "cannot evaluate the solution further right of %1, interrupt requested", evalf[8](_val) elif 100 < _dat[4][9] then if _dat[4][9]-100 = _nv+1 then error "constraint projection failure on event at t=%1", evalf[8](_val) elif _dat[4][9]-100 = _nv+2 then error "index-1 and derivative evaluation failure on event at t=%1", evalf[8](_val) elif _dat[4][9]-100 = _nv+3 then error "maximum number of event iterations reached (%1) at t=%2", round(_dat[3][1][_nv+1, 3]), evalf[8](_val) else if _Env_dsolve_nowarnstop <> true then `dsolve/numeric/warning`(StringTools:-FormatMessage("cannot evaluate the solution further right of %1, event #%2 triggered a halt", evalf[8](_val), round(_dat[3][1][_dat[4][9]-100, 1]))) end if; Rounding := 'nearest'; _xout := _val end if else error "cannot evaluate the solution further right of %1", evalf[8](_val) end if elif _i = 2 and _xout < _val then Rounding := infinity; if _dat[4][9] = 1 then error "cannot evaluate the solution further left of %1, probably a singularity", evalf[8](_val) elif _dat[4][9] = 2 then error "cannot evaluate the solution further left of %1, maxfun limit exceeded (see <a href='http://www.maplesoft.com/support/help/search.aspx?term=dsolve,maxfun' target='_new'>?dsolve,maxfun</a> for details)", evalf[8](_val) elif _dat[4][9] = 3 then if _dat[4][25] = 3 then error "cannot evaluate the solution past the initial point, problem may be initially singular or improperly set up" else error "cannot evaluate the solution past the initial point, problem may be complex, initially singular or improperly set up" end if elif _dat[4][9] = 4 then error "cannot evaluate the solution further left of %1, accuracy goal cannot be achieved with specified 'minstep'", evalf[8](_val) elif _dat[4][9] = 5 then error "cannot evaluate the solution further left of %1, too many step failures, tolerances may be too loose for problem", evalf[8](_val) elif _dat[4][9] = 6 then error "cannot evaluate the solution further left of %1, cannot downgrade delay storage for problems with delay derivative order > 1, try increasing delaypts", evalf[8](_val) elif _dat[4][9] = 10 then error "cannot evaluate the solution further right of %1, interrupt requested", evalf[8](_val) elif 100 < _dat[4][9] then if _dat[4][9]-100 = _nv+1 then error "constraint projection failure on event at t=%1", evalf[8](_val) elif _dat[4][9]-100 = _nv+2 then error "index-1 and derivative evaluation failure on event at t=%1", evalf[8](_val) elif _dat[4][9]-100 = _nv+3 then error "maximum number of event iterations reached (%1) at t=%2", round(_dat[3][1][_nv+1, 3]), evalf[8](_val) else if _Env_dsolve_nowarnstop <> true then `dsolve/numeric/warning`(StringTools:-FormatMessage("cannot evaluate the solution further left of %1, event #%2 triggered a halt", evalf[8](_val), round(_dat[3][1][_dat[4][9]-100, 1]))) end if; Rounding := 'nearest'; _xout := _val end if else error "cannot evaluate the solution further left of %1", evalf[8](_val) end if end if; if _EnvInFsolve = true then _dig := _dat[4][26]; if type(_EnvDSNumericSaveDigits, 'posint') then _dat[4][26] := _EnvDSNumericSaveDigits else _dat[4][26] := Digits end if; _Env_dsolve_SC_native := true; if _dat[4][25] = 1 then _i := 1; _dat[4][25] := 2 else _i := _dat[4][25] end if; _val := `dsolve/numeric/SC/IVPval`(_dat, _xout, _src); _dat[4][25] := _i; _dat[4][26] := _dig; [_xout, seq(_val[_vmap[_i]], _i = 1 .. _n-_ne)] else Digits := _dat[4][26]; _val := `dsolve/numeric/SC/IVPval`(eval(_dat, 2), _xout, _src); [_xout, seq(_val[_vmap[_i]], _i = 1 .. _n-_ne)] end if end proc, (2) = Array(0..0, {}), (3) = [t, epsilon(t), diff(epsilon(t), t), phi1(t), diff(phi1(t), t)], (4) = []}); _vars := _dat[3]; _pars := map(rhs, _dat[4]); _n := nops(_vars)-1; _solnproc := _dat[1]; if not type(_xout, 'numeric') then if member(x_rkf45, ["start", 'start', "method", 'method', "left", 'left', "right", 'right', "leftdata", "rightdata", "enginedata", "eventstop", 'eventstop', "eventclear", 'eventclear', "eventstatus", 'eventstatus', "eventcount", 'eventcount', "laxtol", 'laxtol', "numfun", 'numfun', NULL]) then _res := _solnproc(convert(x_rkf45, 'string')); if 1 < nops([_res]) then return _res elif type(_res, 'array') then return eval(_res, 1) elif _res <> "procname" then return _res end if elif member(x_rkf45, ["last", 'last', "initial", 'initial', "parameters", 'parameters', "initial_and_parameters", 'initial_and_parameters', NULL]) then _xout := convert(x_rkf45, 'string'); _res := _solnproc(_xout); if _xout = "parameters" then return [seq(_pars[_i] = _res[_i], _i = 1 .. nops(_pars))] elif _xout = "initial_and_parameters" then return [seq(_vars[_i+1] = [_res][1][_i+1], _i = 0 .. _n), seq(_pars[_i] = [_res][2][_i], _i = 1 .. nops(_pars))] else return [seq(_vars[_i+1] = _res[_i+1], _i = 0 .. _n)] end if elif type(_xout, `=`) and member(lhs(_xout), ["initial", 'initial', "parameters", 'parameters', "initial_and_parameters", 'initial_and_parameters', NULL]) then _xout := convert(lhs(x_rkf45), 'string') = rhs(x_rkf45); if type(rhs(_xout), 'list') then _res := _solnproc(_xout) else error "initial and/or parameter values must be specified in a list" end if; if lhs(_xout) = "initial" then return [seq(_vars[_i+1] = _res[_i+1], _i = 0 .. _n)] elif lhs(_xout) = "parameters" then return [seq(_pars[_i] = _res[_i], _i = 1 .. nops(_pars))] else return [seq(_vars[_i+1] = [_res][1][_i+1], _i = 0 .. _n), seq(_pars[_i] = [_res][2][_i], _i = 1 .. nops(_pars))] end if elif type(_xout, `=`) and member(lhs(_xout), ["eventdisable", 'eventdisable', "eventenable", 'eventenable', "eventfired", 'eventfired', "direction", 'direction', NULL]) then return _solnproc(convert(lhs(x_rkf45), 'string') = rhs(x_rkf45)) elif _xout = "solnprocedure" then return eval(_solnproc) elif _xout = "sysvars" then return _vars end if; if procname <> unknown then return ('procname')(x_rkf45) else _ndsol := 1; _ndsol := _ndsol; _ndsol := pointto(_dat[2][0]); return ('_ndsol')(x_rkf45) end if end if; try _res := _solnproc(_xout); [seq(_vars[_i+1] = _res[_i+1], _i = 0 .. _n)] catch: error  end try end proc

(12)

odeplot(sol_num, [t, phi1(t), epsilon(t)], t = 0 .. .5); odetest(sol_num, ode_sys)

Error, (in ODEtools/info) Required a specification of the indeterminate function

 

``


 

Download Differential_Equations_Trebuchet_Phase_II_2020-06-05.mw

First 576 577 578 579 580 581 582 Last Page 578 of 2255